Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
4-Bromostyrene, 98%, stab. with 0.1% 4-tert-butylcatechol
CAS: 2039-82-9 Molecular Formula: C8H7Br Molecular Weight (g/mol): 183.05 MDL Number: MFCD00000110 InChI Key: WGGLDBIZIQMEGH-UHFFFAOYSA-N Synonym: 4-bromostyrene,1-bromo-4-vinylbenzene,p-bromostyrene,benzene, 1-bromo-4-ethenyl,styrene, p-bromo,1-4-bromophenyl ethylene,unii-tvk4s80xlu,p-bromo styrene,1-bromo-4-vinyl-benzene,tvk4s80xlu PubChem CID: 16263 IUPAC Name: 1-bromo-4-ethenylbenzene SMILES: BrC1=CC=C(C=C)C=C1
| PubChem CID | 16263 |
|---|---|
| CAS | 2039-82-9 |
| Molecular Weight (g/mol) | 183.05 |
| MDL Number | MFCD00000110 |
| SMILES | BrC1=CC=C(C=C)C=C1 |
| Synonym | 4-bromostyrene,1-bromo-4-vinylbenzene,p-bromostyrene,benzene, 1-bromo-4-ethenyl,styrene, p-bromo,1-4-bromophenyl ethylene,unii-tvk4s80xlu,p-bromo styrene,1-bromo-4-vinyl-benzene,tvk4s80xlu |
| IUPAC Name | 1-bromo-4-ethenylbenzene |
| InChI Key | WGGLDBIZIQMEGH-UHFFFAOYSA-N |
| Molecular Formula | C8H7Br |
Benzoyl fluoride, 97%
CAS: 455-32-3 Molecular Formula: C7H5FO Molecular Weight (g/mol): 124.11 MDL Number: MFCD00000364 InChI Key: HPMLGNIUXVXALD-UHFFFAOYSA-N Synonym: benzoylfluoride,unii-lor25i34hd,lor25i34hd,benzoylfluorid,acmc-1alcy,hpmlgniuxvxald-uhfffaoysa PubChem CID: 67999 IUPAC Name: benzoyl fluoride SMILES: FC(=O)C1=CC=CC=C1
| PubChem CID | 67999 |
|---|---|
| CAS | 455-32-3 |
| Molecular Weight (g/mol) | 124.11 |
| MDL Number | MFCD00000364 |
| SMILES | FC(=O)C1=CC=CC=C1 |
| Synonym | benzoylfluoride,unii-lor25i34hd,lor25i34hd,benzoylfluorid,acmc-1alcy,hpmlgniuxvxald-uhfffaoysa |
| IUPAC Name | benzoyl fluoride |
| InChI Key | HPMLGNIUXVXALD-UHFFFAOYSA-N |
| Molecular Formula | C7H5FO |
alpha-Naphtholphthalein
CAS: 596-01-0 Molecular Formula: C28H18O4 Molecular Weight (g/mol): 418.448 MDL Number: MFCD00036202 InChI Key: HQHBAGKIEAOSNM-UHFFFAOYSA-N Synonym: alpha-naphtholphthalein,naphtholphthalein,1-naphtholphthalein,a-naphtholphthalein,3,3-bis 4-hydroxynaphthalen-1-yl isobenzofuran-1 3h-one,unii-2qeg1706nn,1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-1-naphthalenyl,naphtholphthalein blue,alpha-naphtholphtalein,3,3-bis 4-hydroxy-1-naphthyl phthalide PubChem CID: 68993 IUPAC Name: 3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one SMILES: C1=CC=C2C(=C1)C(=CC=C2O)C3(C4=CC=CC=C4C(=O)O3)C5=CC=C(C6=CC=CC=C65)O
| PubChem CID | 68993 |
|---|---|
| CAS | 596-01-0 |
| Molecular Weight (g/mol) | 418.448 |
| MDL Number | MFCD00036202 |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)C3(C4=CC=CC=C4C(=O)O3)C5=CC=C(C6=CC=CC=C65)O |
| Synonym | alpha-naphtholphthalein,naphtholphthalein,1-naphtholphthalein,a-naphtholphthalein,3,3-bis 4-hydroxynaphthalen-1-yl isobenzofuran-1 3h-one,unii-2qeg1706nn,1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-1-naphthalenyl,naphtholphthalein blue,alpha-naphtholphtalein,3,3-bis 4-hydroxy-1-naphthyl phthalide |
| IUPAC Name | 3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one |
| InChI Key | HQHBAGKIEAOSNM-UHFFFAOYSA-N |
| Molecular Formula | C28H18O4 |
Dibutyl sebacate, 93%
CAS: 109-43-3 Molecular Formula: C18H34O4 Molecular Weight (g/mol): 314.46 MDL Number: MFCD00027218 InChI Key: PYGXAGIECVVIOZ-UHFFFAOYSA-N Synonym: dibutyl sebacate,butyl sebacate,di-n-butyl sebacate,decanedioic acid, dibutyl ester,polycizer dbs,kodaflex dbs,dibutyl sebacinate,staflex dbs,sebacic acid, dibutyl ester,monoplex dbs PubChem CID: 7986 IUPAC Name: dibutyl decanedioate SMILES: CCCCOC(=O)CCCCCCCCC(=O)OCCCC
| PubChem CID | 7986 |
|---|---|
| CAS | 109-43-3 |
| Molecular Weight (g/mol) | 314.46 |
| MDL Number | MFCD00027218 |
| SMILES | CCCCOC(=O)CCCCCCCCC(=O)OCCCC |
| Synonym | dibutyl sebacate,butyl sebacate,di-n-butyl sebacate,decanedioic acid, dibutyl ester,polycizer dbs,kodaflex dbs,dibutyl sebacinate,staflex dbs,sebacic acid, dibutyl ester,monoplex dbs |
| IUPAC Name | dibutyl decanedioate |
| InChI Key | PYGXAGIECVVIOZ-UHFFFAOYSA-N |
| Molecular Formula | C18H34O4 |
Dimethoxymethane, 99.5+%
CAS: 109-87-5 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.09 MDL Number: MFCD00008495 InChI Key: NKDDWNXOKDWJAK-UHFFFAOYSA-N Synonym: methylal,formal,methane, dimethoxy,formaldehyde dimethyl acetal,dimethyl formal,anesthenyl,2,4-dioxapentane,bis methoxy methane,methylene dimethyl ether,methoxymethyl methyl ether PubChem CID: 8020 ChEBI: CHEBI:48341 IUPAC Name: dimethoxymethane SMILES: COCOC
| PubChem CID | 8020 |
|---|---|
| CAS | 109-87-5 |
| Molecular Weight (g/mol) | 76.09 |
| ChEBI | CHEBI:48341 |
| MDL Number | MFCD00008495 |
| SMILES | COCOC |
| Synonym | methylal,formal,methane, dimethoxy,formaldehyde dimethyl acetal,dimethyl formal,anesthenyl,2,4-dioxapentane,bis methoxy methane,methylene dimethyl ether,methoxymethyl methyl ether |
| IUPAC Name | dimethoxymethane |
| InChI Key | NKDDWNXOKDWJAK-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |
Thermo Scientific Chemicals Valsartan
CAS: 137862-53-4 Molecular Formula: C24H29N5O3 Molecular Weight (g/mol): 435.53 InChI Key: ACWBQPMHZXGDFX-QFIPXVFZSA-N IUPAC Name: (2S)-3-methyl-2-(N-{[2'-(2H-1,2,3,4-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl]methyl}pentanamido)butanoic acid SMILES: CCCCC(=O)N(CC1=CC=C(C=C1)C1=CC=CC=C1C1=NNN=N1)[C@@H](C(C)C)C(O)=O
| CAS | 137862-53-4 |
|---|---|
| Molecular Weight (g/mol) | 435.53 |
| SMILES | CCCCC(=O)N(CC1=CC=C(C=C1)C1=CC=CC=C1C1=NNN=N1)[C@@H](C(C)C)C(O)=O |
| IUPAC Name | (2S)-3-methyl-2-(N-{[2'-(2H-1,2,3,4-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl]methyl}pentanamido)butanoic acid |
| InChI Key | ACWBQPMHZXGDFX-QFIPXVFZSA-N |
| Molecular Formula | C24H29N5O3 |
Thermo Scientific Chemicals (S)-(+)-Clopidogrel hydrogensulfate, 98%
CAS: 120202-66-6 Molecular Formula: C16H18ClNO6S2 Molecular Weight (g/mol): 419.89 MDL Number: MFCD00876395,MFCD05865229,MFCD05662337 InChI Key: FDEODCTUSIWGLK-RSAXXLAASA-N Synonym: clopidogrel bisulfate,clopidogrel hydrogen sulfate,iscover,plavix,clopidogrel hemisulfate,s-methyl 2-2-chlorophenyl-2-6,7-dihydrothieno 3,2-c pyridin-5 4h-yl acetate sulfate,clopidogrel sulfate,myogrel,clopidogrel sulphate,clopidogrel bisulphate PubChem CID: 115366 ChEBI: CHEBI:3759 IUPAC Name: methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid SMILES: OS(O)(=O)=O.COC(=O)[C@@H](N1CCC2=C(C1)C=CS2)C1=CC=CC=C1Cl
| PubChem CID | 115366 |
|---|---|
| CAS | 120202-66-6 |
| Molecular Weight (g/mol) | 419.89 |
| ChEBI | CHEBI:3759 |
| MDL Number | MFCD00876395,MFCD05865229,MFCD05662337 |
| SMILES | OS(O)(=O)=O.COC(=O)[C@@H](N1CCC2=C(C1)C=CS2)C1=CC=CC=C1Cl |
| Synonym | clopidogrel bisulfate,clopidogrel hydrogen sulfate,iscover,plavix,clopidogrel hemisulfate,s-methyl 2-2-chlorophenyl-2-6,7-dihydrothieno 3,2-c pyridin-5 4h-yl acetate sulfate,clopidogrel sulfate,myogrel,clopidogrel sulphate,clopidogrel bisulphate |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChI Key | FDEODCTUSIWGLK-RSAXXLAASA-N |
| Molecular Formula | C16H18ClNO6S2 |
2,4,6-Trimethylbenzoic acid, 99%
CAS: 480-63-7 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00002481 InChI Key: FFFIRKXTFQCCKJ-UHFFFAOYSA-N Synonym: mesitoic acid,mesitylenecarboxylic acid,beta-isodurylic acid,benzoic acid, 2,4,6-trimethyl,.beta.-isodurylic acid,unii-4pu2hg6787,2-mesitylenecarboxylic acid,2,4,6-trimethyl-benzoic acid,2,6-trimethylbenzoic acid,benzoic acid,4,6-trimethyl PubChem CID: 10194 ChEBI: CHEBI:64830 IUPAC Name: 2,4,6-trimethylbenzoic acid SMILES: CC1=CC(C)=C(C(O)=O)C(C)=C1
| PubChem CID | 10194 |
|---|---|
| CAS | 480-63-7 |
| Molecular Weight (g/mol) | 164.20 |
| ChEBI | CHEBI:64830 |
| MDL Number | MFCD00002481 |
| SMILES | CC1=CC(C)=C(C(O)=O)C(C)=C1 |
| Synonym | mesitoic acid,mesitylenecarboxylic acid,beta-isodurylic acid,benzoic acid, 2,4,6-trimethyl,.beta.-isodurylic acid,unii-4pu2hg6787,2-mesitylenecarboxylic acid,2,4,6-trimethyl-benzoic acid,2,6-trimethylbenzoic acid,benzoic acid,4,6-trimethyl |
| IUPAC Name | 2,4,6-trimethylbenzoic acid |
| InChI Key | FFFIRKXTFQCCKJ-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
D-Glucurono-6,3-lactone, 99%
CAS: 32449-92-6 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.124 MDL Number: MFCD00135622 InChI Key: UYUXSRADSPPKRZ-KKQCNMDGSA-N Synonym: d-glucuro-3,6-lactone PubChem CID: 91634076 IUPAC Name: (2S)-2-[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde SMILES: C(=O)C(C1C(C(C(=O)O1)O)O)O
| PubChem CID | 91634076 |
|---|---|
| CAS | 32449-92-6 |
| Molecular Weight (g/mol) | 176.124 |
| MDL Number | MFCD00135622 |
| SMILES | C(=O)C(C1C(C(C(=O)O1)O)O)O |
| Synonym | d-glucuro-3,6-lactone |
| IUPAC Name | (2S)-2-[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde |
| InChI Key | UYUXSRADSPPKRZ-KKQCNMDGSA-N |
| Molecular Formula | C6H8O6 |
Thermo Scientific Chemicals 5(6)-Carboxyfluorescein
CAS: 72088-94-9 Molecular Formula: C42H24O14 Molecular Weight (g/mol): 752.64 MDL Number: MFCD00151081 InChI Key: BPVHBBXCESDRKW-UHFFFAOYSA-N Synonym: 5 6-fam,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-5-carboxylic acid compound with 3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid 1:1,5-and-6-fam,5-and-6-carboxyfluorescein,5-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, dye content 90 %,5 6-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, bioreagent, suitable for fluorescence hplc,3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-5-carboxylic acid compound with 3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-6-carboxylic acid 1:1,4 5-carboxyfluorescein; 3',6'-dihydroxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5 6-carboxylic acid PubChem CID: 44119975 IUPAC Name: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid SMILES: OC(=O)C1=CC2=C(C=C1)C1(OC2=O)C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2.OC(=O)C1=CC2=C(C=C1)C(=O)OC21C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2
| PubChem CID | 44119975 |
|---|---|
| CAS | 72088-94-9 |
| Molecular Weight (g/mol) | 752.64 |
| MDL Number | MFCD00151081 |
| SMILES | OC(=O)C1=CC2=C(C=C1)C1(OC2=O)C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2.OC(=O)C1=CC2=C(C=C1)C(=O)OC21C2=C(OC3=C1C=CC(O)=C3)C=C(O)C=C2 |
| Synonym | 5 6-fam,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-5-carboxylic acid compound with 3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid 1:1,5-and-6-fam,5-and-6-carboxyfluorescein,5-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, dye content 90 %,5 6-carboxyfluorescein; carboxyfluorescein,5 6-carboxyfluorescein, bioreagent, suitable for fluorescence hplc,3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-5-carboxylic acid compound with 3,6-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9-xanthene-6-carboxylic acid 1:1,4 5-carboxyfluorescein; 3',6'-dihydroxy-3-oxospiro 2-benzofuran-1,9'-xanthene-5 6-carboxylic acid |
| IUPAC Name | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid;3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| InChI Key | BPVHBBXCESDRKW-UHFFFAOYSA-N |
| Molecular Formula | C42H24O14 |
Chloroacetic acid, 99+%, ACS reagent
CAS: 79-11-8 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.5 InChI Key: FOCAUTSVDIKZOP-UHFFFAOYSA-N Synonym: chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure PubChem CID: 300 ChEBI: CHEBI:27869 IUPAC Name: 2-chloroacetic acid SMILES: C(C(=O)O)Cl
| PubChem CID | 300 |
|---|---|
| CAS | 79-11-8 |
| Molecular Weight (g/mol) | 94.5 |
| ChEBI | CHEBI:27869 |
| SMILES | C(C(=O)O)Cl |
| Synonym | chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure |
| IUPAC Name | 2-chloroacetic acid |
| InChI Key | FOCAUTSVDIKZOP-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |
Caffeine, 98.5%, specified according to the req. of USP/BP
CAS: 58-08-2 Molecular Formula: C8H10N4O2 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00005758 InChI Key: RYYVLZVUVIJVGH-UHFFFAOYSA-N Synonym: caffeine,1,3,7-trimethylxanthine,guaranine,thein,cafeina,methyltheobromine,koffein,mateina,theine,alert-pep PubChem CID: 2519 ChEBI: CHEBI:27732 IUPAC Name: 1,3,7-trimethylpurine-2,6-dione SMILES: CN1C=NC2=C1C(=O)N(C)C(=O)N2C
| PubChem CID | 2519 |
|---|---|
| CAS | 58-08-2 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:27732 |
| MDL Number | MFCD00005758 |
| SMILES | CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| Synonym | caffeine,1,3,7-trimethylxanthine,guaranine,thein,cafeina,methyltheobromine,koffein,mateina,theine,alert-pep |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| InChI Key | RYYVLZVUVIJVGH-UHFFFAOYSA-N |
| Molecular Formula | C8H10N4O2 |
Riboflavin-5'-phosphate sodium salt dihydrate, 73.0% min.
CAS: 6184-17-4 Molecular Formula: C17H24N4NaO11P Molecular Weight (g/mol): 514.36 MDL Number: MFCD00150993 InChI Key: LQVGUKOCMOKKJU-FTNKLFHDNA-M Synonym: riboflavin 5'-monophosphate sodium salt dihydrate PubChem CID: 131856174 IUPAC Name: [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] dihydrogen phosphate;sodium;dihydrate SMILES: O.O.[Na+].CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)COP(O)([O-])=O)C3=NC(=O)NC(=O)C3=NC2=C1
| PubChem CID | 131856174 |
|---|---|
| CAS | 6184-17-4 |
| Molecular Weight (g/mol) | 514.36 |
| MDL Number | MFCD00150993 |
| SMILES | O.O.[Na+].CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)COP(O)([O-])=O)C3=NC(=O)NC(=O)C3=NC2=C1 |
| Synonym | riboflavin 5'-monophosphate sodium salt dihydrate |
| IUPAC Name | [(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-trihydroxypentyl] dihydrogen phosphate;sodium;dihydrate |
| InChI Key | LQVGUKOCMOKKJU-FTNKLFHDNA-M |
| Molecular Formula | C17H24N4NaO11P |
1,12-Dibromododecane, 98%
CAS: 3344-70-5 Molecular Formula: C12H24Br2 Molecular Weight (g/mol): 328.132 MDL Number: MFCD00000226 InChI Key: ZJJATABWMGVVRZ-UHFFFAOYSA-N Synonym: dodecamethylene dibromide,dodecane, 1,12-dibromo,alpha,omega-dibromododecane,labotest-bb ltbb002671,pubchem3879,1, 12-dibromododecane,1,12-dibromo-dodecane,1,12-bis bromanyl dodecane,4-01-00-00503 beilstein handbook reference,ksc225m2h PubChem CID: 18766 IUPAC Name: 1,12-dibromododecane SMILES: C(CCCCCCBr)CCCCCBr
| PubChem CID | 18766 |
|---|---|
| CAS | 3344-70-5 |
| Molecular Weight (g/mol) | 328.132 |
| MDL Number | MFCD00000226 |
| SMILES | C(CCCCCCBr)CCCCCBr |
| Synonym | dodecamethylene dibromide,dodecane, 1,12-dibromo,alpha,omega-dibromododecane,labotest-bb ltbb002671,pubchem3879,1, 12-dibromododecane,1,12-dibromo-dodecane,1,12-bis bromanyl dodecane,4-01-00-00503 beilstein handbook reference,ksc225m2h |
| IUPAC Name | 1,12-dibromododecane |
| InChI Key | ZJJATABWMGVVRZ-UHFFFAOYSA-N |
| Molecular Formula | C12H24Br2 |
m-Carborane, 98%, Thermo Scientific Chemicals
CAS: 16986-24-6 Molecular Formula: C2H12B10 Molecular Weight (g/mol): 144.25 MDL Number: MFCD00151574 InChI Key: JTWJUVSLJRLZFF-UHFFFAOYSA-N Synonym: m-carborane,1,7-dicarbadodecaborane 12,2,3,4,5,6,7,8,9,11,12-decaborabicyclo 8.1.1 dodecane PubChem CID: 16212388 IUPAC Name: 2$l^{2},3$l^{2},4$l^{2},5$l^{2},6$l^{2},7$l^{2},8$l^{2},9$l^{2},11$l^{2},12$l^{2}-decaborabicyclo[8.1.1]dodecane SMILES: [B]1C2[B]C1[B][B][B][B][B][B][B][B]2
| PubChem CID | 16212388 |
|---|---|
| CAS | 16986-24-6 |
| Molecular Weight (g/mol) | 144.25 |
| MDL Number | MFCD00151574 |
| SMILES | [B]1C2[B]C1[B][B][B][B][B][B][B][B]2 |
| Synonym | m-carborane,1,7-dicarbadodecaborane 12,2,3,4,5,6,7,8,9,11,12-decaborabicyclo 8.1.1 dodecane |
| IUPAC Name | 2$l^{2},3$l^{2},4$l^{2},5$l^{2},6$l^{2},7$l^{2},8$l^{2},9$l^{2},11$l^{2},12$l^{2}-decaborabicyclo[8.1.1]dodecane |
| InChI Key | JTWJUVSLJRLZFF-UHFFFAOYSA-N |
| Molecular Formula | C2H12B10 |